C15H16ClNO3S — CID 676240
3-(3-chloro-2,4-dimethoxyanilino)-1-thiophen-2-ylpropan-1-one (PubChem CID 676240) has the molecular formula C15H16ClNO3S and a molecular weight of 325.82 g/mol. Its IUPAC name is 3-(3-chloro-2,4-dimethoxyanilino)-1-thiophen-2-ylpropan-1-one.
| Compound Name | 3-(3-chloro-2,4-dimethoxyanilino)-1-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 676240 |
| Molecular Formula | C15H16ClNO3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 3-(3-chloro-2,4-dimethoxyanilino)-1-thiophen-2-ylpropan-1-one |
| SMILES | COc1ccc(NCCC(=O)c2cccs2)c(OC)c1Cl |
| InChI | InChI=1S/C15H16ClNO3S/c1-19-12-6-5-10(15(20-2)14(12)16)17-8-7-11(18)13-4-3-9-21-13/h3-6,9,17H,7-8H2,1-2H3 |
| InChIKey | QVDBVFIKMUTUAA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|