C21H21Cl2FN4OS — CID 164877450
3-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-2-fluoro-N-[2-(1-methylazetidin-3-yl)ethyl]benzamide (PubChem CID 164877450) has the molecular formula C21H21Cl2FN4OS and a molecular weight of 467.40 g/mol. Its IUPAC name is 3-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-2-fluoro-N-[2-(1-methylazetidin-3-yl)ethyl]benzamide.
| Compound Name | 3-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-2-fluoro-N-[2-(1-methylazetidin-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 164877450 |
| Molecular Formula | C21H21Cl2FN4OS |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 3-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-2-fluoro-N-[2-(1-methylazetidin-3-yl)ethyl]benzamide |
| SMILES | CN1CC(CCNC(=O)c2cccc(SNc3ccc(Cl)c4c(Cl)c[nH]c34)c2F)C1 |
| InChI | InChI=1S/C21H21Cl2FN4OS/c1-28-10-12(11-28)7-8-25-21(29)13-3-2-4-17(19(13)24)30-27-16-6-5-14(22)18-15(23)9-26-20(16)18/h2-6,9,12,26-27H,7-8,10-11H2,1H3,(H,25,29) |
| InChIKey | DXPYCZMDVXPCIY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|