C14H19ClFN3O — CID 117044847
5-chloro-2-fluoro-N-[2-(4-methylpiperazin-2-yl)ethyl]benzamide (PubChem CID 117044847) has the molecular formula C14H19ClFN3O and a molecular weight of 299.78 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-[2-(4-methylpiperazin-2-yl)ethyl]benzamide.
| Compound Name | 5-chloro-2-fluoro-N-[2-(4-methylpiperazin-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 117044847 |
| Molecular Formula | C14H19ClFN3O |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 5-chloro-2-fluoro-N-[2-(4-methylpiperazin-2-yl)ethyl]benzamide |
| SMILES | CN1CCNC(CCNC(=O)c2cc(Cl)ccc2F)C1 |
| InChI | InChI=1S/C14H19ClFN3O/c1-19-7-6-17-11(9-19)4-5-18-14(20)12-8-10(15)2-3-13(12)16/h2-3,8,11,17H,4-7,9H2,1H3,(H,18,20) |
| InChIKey | PVYSONHPVCMMDJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |