C13H19BrFN3 — CID 115239342
5-bromo-2-fluoro-N-[2-(4-methylpiperazin-2-yl)ethyl]aniline (PubChem CID 115239342) has the molecular formula C13H19BrFN3 and a molecular weight of 316.22 g/mol. Its IUPAC name is 5-bromo-2-fluoro-N-[2-(4-methylpiperazin-2-yl)ethyl]aniline.
| Compound Name | 5-bromo-2-fluoro-N-[2-(4-methylpiperazin-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 115239342 |
| Molecular Formula | C13H19BrFN3 |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 5-bromo-2-fluoro-N-[2-(4-methylpiperazin-2-yl)ethyl]aniline |
| SMILES | CN1CCNC(CCNc2cc(Br)ccc2F)C1 |
| InChI | InChI=1S/C13H19BrFN3/c1-18-7-6-16-11(9-18)4-5-17-13-8-10(14)2-3-12(13)15/h2-3,8,11,16-17H,4-7,9H2,1H3 |
| InChIKey | HIWQUIKEYKZJAQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |