C14H21BrFN3 — CID 116956912
1-(5-bromo-2-fluorophenyl)-N-methyl-2-(4-methylpiperazin-2-yl)ethanamine (PubChem CID 116956912) has the molecular formula C14H21BrFN3 and a molecular weight of 330.25 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-N-methyl-2-(4-methylpiperazin-2-yl)ethanamine.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-N-methyl-2-(4-methylpiperazin-2-yl)ethanamine |
|---|---|
| PubChem CID | 116956912 |
| Molecular Formula | C14H21BrFN3 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-N-methyl-2-(4-methylpiperazin-2-yl)ethanamine |
| SMILES | CNC(CC1CN(C)CCN1)c1cc(Br)ccc1F |
| InChI | InChI=1S/C14H21BrFN3/c1-17-14(8-11-9-19(2)6-5-18-11)12-7-10(15)3-4-13(12)16/h3-4,7,11,14,17-18H,5-6,8-9H2,1-2H3 |
| InChIKey | VVYHKLNAOOTYLT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |