C13H18BrFN2 — CID 116951610
1-(5-bromo-2-fluorophenyl)-N-methyl-2-pyrrolidin-3-ylethanamine (PubChem CID 116951610) has the molecular formula C13H18BrFN2 and a molecular weight of 301.20 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-N-methyl-2-pyrrolidin-3-ylethanamine.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-N-methyl-2-pyrrolidin-3-ylethanamine |
|---|---|
| PubChem CID | 116951610 |
| Molecular Formula | C13H18BrFN2 |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-N-methyl-2-pyrrolidin-3-ylethanamine |
| SMILES | CNC(CC1CCNC1)c1cc(Br)ccc1F |
| InChI | InChI=1S/C13H18BrFN2/c1-16-13(6-9-4-5-17-8-9)11-7-10(14)2-3-12(11)15/h2-3,7,9,13,16-17H,4-6,8H2,1H3 |
| InChIKey | SZGACGKFIXHRRS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |