C22H28N2O6 — CID 158499446
tert-butyl N-[[3-[(2,4-dioxocyclohexyl)carbamoyl]-4-[(E)-2-methoxyethenyl]phenyl]methyl]carbamate (PubChem CID 158499446) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is tert-butyl N-[[3-[(2,4-dioxocyclohexyl)carbamoyl]-4-[(E)-2-methoxyethenyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[(2,4-dioxocyclohexyl)carbamoyl]-4-[(E)-2-methoxyethenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 158499446 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | tert-butyl N-[[3-[(2,4-dioxocyclohexyl)carbamoyl]-4-[(E)-2-methoxyethenyl]phenyl]methyl]carbamate |
| SMILES | CO/C=C/c1ccc(CNC(=O)OC(C)(C)C)cc1C(=O)NC1CCC(=O)CC1=O |
| InChI | InChI=1S/C22H28N2O6/c1-22(2,3)30-21(28)23-13-14-5-6-15(9-10-29-4)17(11-14)20(27)24-18-8-7-16(25)12-19(18)26/h5-6,9-11,18H,7-8,12-13H2,1-4H3,(H,23,28)(H,24,27)/b10-9+ |
| InChIKey | ZNKCGIBDWUTNEZ-MDZDMXLPSA-N |
| XLogP | 2.75 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|