C24H27Cl2N3O5 — CID 67690889
methyl (2R,4S)-5,7-dichloro-4-[[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoyl]amino]-1,2,3,4-tetrahydroquinoline-2-carboxylate (PubChem CID 67690889) has the molecular formula C24H27Cl2N3O5 and a molecular weight of 508.40 g/mol. Its IUPAC name is methyl (2R,4S)-5,7-dichloro-4-[[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoyl]amino]-1,2,3,4-tetrahydroquinoline-2-carboxylate.
| Compound Name | methyl (2R,4S)-5,7-dichloro-4-[[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoyl]amino]-1,2,3,4-tetrahydroquinoline-2-carboxylate |
|---|---|
| PubChem CID | 67690889 |
| Molecular Formula | C24H27Cl2N3O5 |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | methyl (2R,4S)-5,7-dichloro-4-[[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoyl]amino]-1,2,3,4-tetrahydroquinoline-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H](NC(=O)c2cccc(CNC(=O)OC(C)(C)C)c2)c2c(Cl)cc(Cl)cc2N1 |
| InChI | InChI=1S/C24H27Cl2N3O5/c1-24(2,3)34-23(32)27-12-13-6-5-7-14(8-13)21(30)29-18-11-19(22(31)33-4)28-17-10-15(25)9-16(26)20(17)18/h5-10,18-19,28H,11-12H2,1-4H3,(H,27,32)(H,29,30)/t18-,19+/m0/s1 |
| InChIKey | LOAJDRFBZXEPGL-RBUKOAKNSA-N |
| XLogP | 4.85 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |