C18H15Cl3N2O3 — CID 54157557
(2S,4R)-5,7-dichloro-4-[[2-(4-chlorophenyl)acetyl]amino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid (PubChem CID 54157557) has the molecular formula C18H15Cl3N2O3 and a molecular weight of 413.69 g/mol. Its IUPAC name is (2S,4R)-5,7-dichloro-4-[[2-(4-chlorophenyl)acetyl]amino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid.
| Compound Name | (2S,4R)-5,7-dichloro-4-[[2-(4-chlorophenyl)acetyl]amino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 54157557 |
| Molecular Formula | C18H15Cl3N2O3 |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | (2S,4R)-5,7-dichloro-4-[[2-(4-chlorophenyl)acetyl]amino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
| SMILES | O=C(Cc1ccc(Cl)cc1)N[C@@H]1C[C@@H](C(=O)O)Nc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C18H15Cl3N2O3/c19-10-3-1-9(2-4-10)5-16(24)23-14-8-15(18(25)26)22-13-7-11(20)6-12(21)17(13)14/h1-4,6-7,14-15,22H,5,8H2,(H,23,24)(H,25,26)/t14-,15+/m1/s1 |
| InChIKey | OMDXSCVBMWCLNN-CABCVRRESA-N |
| XLogP | 4.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |