C24H26Cl2N2O5 — CID 19747485
2,2-dimethylpropanoyloxymethyl 5,7-dichloro-4-[(2-phenylacetyl)amino]-1,2,3,4-tetrahydroquinoline-2-carboxylate (PubChem CID 19747485) has the molecular formula C24H26Cl2N2O5 and a molecular weight of 493.39 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl 5,7-dichloro-4-[(2-phenylacetyl)amino]-1,2,3,4-tetrahydroquinoline-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl 5,7-dichloro-4-[(2-phenylacetyl)amino]-1,2,3,4-tetrahydroquinoline-2-carboxylate |
|---|---|
| PubChem CID | 19747485 |
| Molecular Formula | C24H26Cl2N2O5 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl 5,7-dichloro-4-[(2-phenylacetyl)amino]-1,2,3,4-tetrahydroquinoline-2-carboxylate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)C1CC(NC(=O)Cc2ccccc2)c2c(Cl)cc(Cl)cc2N1 |
| InChI | InChI=1S/C24H26Cl2N2O5/c1-24(2,3)23(31)33-13-32-22(30)19-12-18(21-16(26)10-15(25)11-17(21)27-19)28-20(29)9-14-7-5-4-6-8-14/h4-8,10-11,18-19,27H,9,12-13H2,1-3H3,(H,28,29) |
| InChIKey | XXROTNVKFKTTGS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|