C25H31Cl2N3O3 — CID 67691130
hexyl (2R,4S)-4-[[2-[4-(aminomethyl)phenyl]acetyl]amino]-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylate (PubChem CID 67691130) has the molecular formula C25H31Cl2N3O3 and a molecular weight of 492.45 g/mol. Its IUPAC name is hexyl (2R,4S)-4-[[2-[4-(aminomethyl)phenyl]acetyl]amino]-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylate.
| Compound Name | hexyl (2R,4S)-4-[[2-[4-(aminomethyl)phenyl]acetyl]amino]-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylate |
|---|---|
| PubChem CID | 67691130 |
| Molecular Formula | C25H31Cl2N3O3 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | hexyl (2R,4S)-4-[[2-[4-(aminomethyl)phenyl]acetyl]amino]-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylate |
| SMILES | CCCCCCOC(=O)[C@H]1C[C@H](NC(=O)Cc2ccc(CN)cc2)c2c(Cl)cc(Cl)cc2N1 |
| InChI | InChI=1S/C25H31Cl2N3O3/c1-2-3-4-5-10-33-25(32)22-14-21(24-19(27)12-18(26)13-20(24)29-22)30-23(31)11-16-6-8-17(15-28)9-7-16/h6-9,12-13,21-22,29H,2-5,10-11,14-15,28H2,1H3,(H,30,31)/t21-,22+/m0/s1 |
| InChIKey | DFBGXLFBBUGWBK-FCHUYYIVSA-N |
| XLogP | 5.16 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|