C21H30N2O3 — CID 175843419
tert-butyl N-[[4-(bicyclo[2.2.2]octane-1-carbonylamino)phenyl]methyl]carbamate (PubChem CID 175843419) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is tert-butyl N-[[4-(bicyclo[2.2.2]octane-1-carbonylamino)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(bicyclo[2.2.2]octane-1-carbonylamino)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 175843419 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | tert-butyl N-[[4-(bicyclo[2.2.2]octane-1-carbonylamino)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(NC(=O)C23CCC(CC2)CC3)cc1 |
| InChI | InChI=1S/C21H30N2O3/c1-20(2,3)26-19(25)22-14-16-4-6-17(7-5-16)23-18(24)21-11-8-15(9-12-21)10-13-21/h4-7,15H,8-14H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | REPVAHVJNMONOA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |