C19H22N2O7 — CID 118656743
(2,5-dioxopyrrolidin-1-yl) (E)-3-[2-hydroxy-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]prop-2-enoate (PubChem CID 118656743) has the molecular formula C19H22N2O7 and a molecular weight of 390.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (E)-3-[2-hydroxy-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]prop-2-enoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (E)-3-[2-hydroxy-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 118656743 |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (E)-3-[2-hydroxy-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(/C=C/C(=O)ON2C(=O)CCC2=O)c(O)c1 |
| InChI | InChI=1S/C19H22N2O7/c1-19(2,3)27-18(26)20-11-12-4-5-13(14(22)10-12)6-9-17(25)28-21-15(23)7-8-16(21)24/h4-6,9-10,22H,7-8,11H2,1-3H3,(H,20,26)/b9-6+ |
| InChIKey | XLLXVMSXTYWGDL-RMKNXTFCSA-N |
| XLogP | 2.04 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|