C16H29N3O4 — CID 107442391
tert-butyl N-[2-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-3-methylbutyl]carbamate (PubChem CID 107442391) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 107442391 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | tert-butyl N-[2-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-3-methylbutyl]carbamate |
| SMILES | CC(C)C(CNC(=O)OC(C)(C)C)CNC1CCC(=O)NC1=O |
| InChI | InChI=1S/C16H29N3O4/c1-10(2)11(9-18-15(22)23-16(3,4)5)8-17-12-6-7-13(20)19-14(12)21/h10-12,17H,6-9H2,1-5H3,(H,18,22)(H,19,20,21) |
| InChIKey | MXTAHLUTACXGLF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|