C17H33N3O3 — CID 107442318
tert-butyl N-[3-methyl-2-[[(1-methyl-6-oxopiperidin-3-yl)amino]methyl]butyl]carbamate (PubChem CID 107442318) has the molecular formula C17H33N3O3 and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-2-[[(1-methyl-6-oxopiperidin-3-yl)amino]methyl]butyl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-2-[[(1-methyl-6-oxopiperidin-3-yl)amino]methyl]butyl]carbamate |
|---|---|
| PubChem CID | 107442318 |
| Molecular Formula | C17H33N3O3 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.25 |
| IUPAC Name | tert-butyl N-[3-methyl-2-[[(1-methyl-6-oxopiperidin-3-yl)amino]methyl]butyl]carbamate |
| SMILES | CC(C)C(CNC(=O)OC(C)(C)C)CNC1CCC(=O)N(C)C1 |
| InChI | InChI=1S/C17H33N3O3/c1-12(2)13(10-19-16(22)23-17(3,4)5)9-18-14-7-8-15(21)20(6)11-14/h12-14,18H,7-11H2,1-6H3,(H,19,22) |
| InChIKey | UUKUYEGRKKJIIP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |