C29H30N4O3 — CID 162729003
3-[8-[2-[4-(azepan-1-ylmethyl)phenyl]ethynyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione (PubChem CID 162729003) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is 3-[8-[2-[4-(azepan-1-ylmethyl)phenyl]ethynyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[8-[2-[4-(azepan-1-ylmethyl)phenyl]ethynyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162729003 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 3-[8-[2-[4-(azepan-1-ylmethyl)phenyl]ethynyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
| SMILES | Cc1nc2c(C#Cc3ccc(CN4CCCCCC4)cc3)cccc2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C29H30N4O3/c1-20-30-27-23(7-6-8-24(27)29(36)33(20)25-15-16-26(34)31-28(25)35)14-13-21-9-11-22(12-10-21)19-32-17-4-2-3-5-18-32/h6-12,25H,2-5,15-19H2,1H3,(H,31,34,35) |
| InChIKey | YTAJCARVFQQUNL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|