C28H28N4O3 — CID 162728988
3-[2-methyl-4-oxo-8-[2-[4-(piperidin-1-ylmethyl)phenyl]ethynyl]quinazolin-3-yl]piperidine-2,6-dione (PubChem CID 162728988) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 3-[2-methyl-4-oxo-8-[2-[4-(piperidin-1-ylmethyl)phenyl]ethynyl]quinazolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-methyl-4-oxo-8-[2-[4-(piperidin-1-ylmethyl)phenyl]ethynyl]quinazolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162728988 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 3-[2-methyl-4-oxo-8-[2-[4-(piperidin-1-ylmethyl)phenyl]ethynyl]quinazolin-3-yl]piperidine-2,6-dione |
| SMILES | Cc1nc2c(C#Cc3ccc(CN4CCCCC4)cc3)cccc2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C28H28N4O3/c1-19-29-26-22(13-12-20-8-10-21(11-9-20)18-31-16-3-2-4-17-31)6-5-7-23(26)28(35)32(19)24-14-15-25(33)30-27(24)34/h5-11,24H,2-4,14-18H2,1H3,(H,30,33,34) |
| InChIKey | NGLPYHBBULLTCX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|