C23H28N4O4 — CID 138695172
3-[5-[3-[2-(2-aminoethoxy)ethoxy]propyl]pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione (PubChem CID 138695172) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-[5-[3-[2-(2-aminoethoxy)ethoxy]propyl]pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[3-[2-(2-aminoethoxy)ethoxy]propyl]pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 138695172 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 3-[5-[3-[2-(2-aminoethoxy)ethoxy]propyl]pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione |
| SMILES | NCCOCCOCCCc1cccc2c1c1cccnc1n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C23H28N4O4/c24-10-13-31-15-14-30-12-3-5-16-4-1-7-18-21(16)17-6-2-11-25-22(17)27(18)19-8-9-20(28)26-23(19)29/h1-2,4,6-7,11,19H,3,5,8-10,12-15,24H2,(H,26,28,29) |
| InChIKey | OMGVNMQAPNGFCJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|