C21H21N3O3 — CID 151240446
5-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-5-yl]pentanal (PubChem CID 151240446) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 5-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-5-yl]pentanal.
| Compound Name | 5-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-5-yl]pentanal |
|---|---|
| PubChem CID | 151240446 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 5-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-5-yl]pentanal |
| SMILES | O=CCCCCc1cccc2c1c1cccnc1n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C21H21N3O3/c25-13-3-1-2-6-14-7-4-9-16-19(14)15-8-5-12-22-20(15)24(16)17-10-11-18(26)23-21(17)27/h4-5,7-9,12-13,17H,1-3,6,10-11H2,(H,23,26,27) |
| InChIKey | NQEPQFOXSPQZOG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|