C33H25N5O4 — CID 153390253
3-[2-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-7-yl]carbazol-9-yl]piperidine-2,6-dione (PubChem CID 153390253) has the molecular formula C33H25N5O4 and a molecular weight of 555.59 g/mol. Its IUPAC name is 3-[2-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-7-yl]carbazol-9-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-7-yl]carbazol-9-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 153390253 |
| Molecular Formula | C33H25N5O4 |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 3-[2-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-7-yl]carbazol-9-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2c3ccccc3c3ccc(-c4ccc5c6cccnc6n(C6CCC(=O)NC6=O)c5c4)cc32)C(=O)N1 |
| InChI | InChI=1S/C33H25N5O4/c39-29-13-11-25(32(41)35-29)37-24-6-2-1-4-20(24)21-9-7-18(16-27(21)37)19-8-10-22-23-5-3-15-34-31(23)38(28(22)17-19)26-12-14-30(40)36-33(26)42/h1-10,15-17,25-26H,11-14H2,(H,35,39,41)(H,36,40,42) |
| InChIKey | BDWKXGRUWXIXQM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|