C21H23N3O2 — CID 166800756
3-[3-(2-methylbutan-2-yl)pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione (PubChem CID 166800756) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-[3-(2-methylbutan-2-yl)pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-(2-methylbutan-2-yl)pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166800756 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 3-[3-(2-methylbutan-2-yl)pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione |
| SMILES | CCC(C)(C)c1cnc2c(c1)c1ccccc1n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C21H23N3O2/c1-4-21(2,3)13-11-15-14-7-5-6-8-16(14)24(19(15)22-12-13)17-9-10-18(25)23-20(17)26/h5-8,11-12,17H,4,9-10H2,1-3H3,(H,23,25,26) |
| InChIKey | DGTUXUWECGZRPZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|