C20H17N3O2 — CID 167693243
3-(4-but-1-ynylpyrido[2,3-b]indol-9-yl)piperidine-2,6-dione (PubChem CID 167693243) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 3-(4-but-1-ynylpyrido[2,3-b]indol-9-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-but-1-ynylpyrido[2,3-b]indol-9-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 167693243 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-(4-but-1-ynylpyrido[2,3-b]indol-9-yl)piperidine-2,6-dione |
| SMILES | CCC#Cc1ccnc2c1c1ccccc1n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C20H17N3O2/c1-2-3-6-13-11-12-21-19-18(13)14-7-4-5-8-15(14)23(19)16-9-10-17(24)22-20(16)25/h4-5,7-8,11-12,16H,2,9-10H2,1H3,(H,22,24,25) |
| InChIKey | WBGSHQIPDHNMDG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|