C31H39N5O4 — CID 146599231
tert-butyl 2-[3-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-4-yl]propyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate (PubChem CID 146599231) has the molecular formula C31H39N5O4 and a molecular weight of 545.68 g/mol. Its IUPAC name is tert-butyl 2-[3-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-4-yl]propyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate.
| Compound Name | tert-butyl 2-[3-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-4-yl]propyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 146599231 |
| Molecular Formula | C31H39N5O4 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | tert-butyl 2-[3-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-4-yl]propyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CN(CCCc1ccnc3c1c1ccccc1n3C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C31H39N5O4/c1-30(2,3)40-29(39)35-17-13-31(14-18-35)19-34(20-31)16-6-7-21-12-15-32-27-26(21)22-8-4-5-9-23(22)36(27)24-10-11-25(37)33-28(24)38/h4-5,8-9,12,15,24H,6-7,10-11,13-14,16-20H2,1-3H3,(H,33,37,38) |
| InChIKey | UGYXOKFZDYYAHM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|