C17H13N3O3 — CID 146598559
9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indole-4-carbaldehyde (PubChem CID 146598559) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indole-4-carbaldehyde.
| Compound Name | 9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indole-4-carbaldehyde |
|---|---|
| PubChem CID | 146598559 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indole-4-carbaldehyde |
| SMILES | O=Cc1ccnc2c1c1ccccc1n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C17H13N3O3/c21-9-10-7-8-18-16-15(10)11-3-1-2-4-12(11)20(16)13-5-6-14(22)19-17(13)23/h1-4,7-9,13H,5-6H2,(H,19,22,23) |
| InChIKey | ZIYPWLOSSMMNQB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|