C17H19FN2O2 — CID 170953295
3-(4-fluoro-3-methyl-5-propan-2-ylindol-1-yl)piperidine-2,6-dione (PubChem CID 170953295) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is 3-(4-fluoro-3-methyl-5-propan-2-ylindol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-fluoro-3-methyl-5-propan-2-ylindol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170953295 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 3-(4-fluoro-3-methyl-5-propan-2-ylindol-1-yl)piperidine-2,6-dione |
| SMILES | Cc1cn(C2CCC(=O)NC2=O)c2ccc(C(C)C)c(F)c12 |
| InChI | InChI=1S/C17H19FN2O2/c1-9(2)11-4-5-12-15(16(11)18)10(3)8-20(12)13-6-7-14(21)19-17(13)22/h4-5,8-9,13H,6-7H2,1-3H3,(H,19,21,22) |
| InChIKey | CKLIUTJERPNNGN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|