C29H36N4O6 — CID 142615891
tert-butyl N-[2-[2-[(E)-3-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-7-yl]but-2-enoxy]ethoxy]ethyl]carbamate (PubChem CID 142615891) has the molecular formula C29H36N4O6 and a molecular weight of 536.63 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[(E)-3-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-7-yl]but-2-enoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[(E)-3-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-7-yl]but-2-enoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 142615891 |
| Molecular Formula | C29H36N4O6 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | tert-butyl N-[2-[2-[(E)-3-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-7-yl]but-2-enoxy]ethoxy]ethyl]carbamate |
| SMILES | C/C(=C\COCCOCCNC(=O)OC(C)(C)C)c1ccc2c3cccnc3n(C3CCC(=O)NC3=O)c2c1 |
| InChI | InChI=1S/C29H36N4O6/c1-19(11-14-37-16-17-38-15-13-31-28(36)39-29(2,3)4)20-7-8-21-22-6-5-12-30-26(22)33(24(21)18-20)23-9-10-25(34)32-27(23)35/h5-8,11-12,18,23H,9-10,13-17H2,1-4H3,(H,31,36)(H,32,34,35)/b19-11+ |
| InChIKey | HJWCTRMGUGTMQE-YBFXNURJSA-N |
| XLogP | 4.13 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|