C38H45N3O4Si — CID 156858879
3-[5-[(E)-2-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]ethenyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 156858879) has the molecular formula C38H45N3O4Si and a molecular weight of 635.88 g/mol. Its IUPAC name is 3-[5-[(E)-2-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]ethenyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[(E)-2-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]ethenyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156858879 |
| Molecular Formula | C38H45N3O4Si |
| Molecular Weight | 635.88 g/mol |
| Exact Mass | 635.32 |
| IUPAC Name | 3-[5-[(E)-2-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]ethenyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(/C=C/C3CCC(CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)CC3)cc21 |
| InChI | InChI=1S/C38H45N3O4Si/c1-38(2,3)46(30-11-7-5-8-12-30,31-13-9-6-10-14-31)45-26-29-19-16-27(17-20-29)15-18-28-21-22-32-34(25-28)40(4)37(44)41(32)33-23-24-35(42)39-36(33)43/h5-15,18,21-22,25,27,29,33H,16-17,19-20,23-24,26H2,1-4H3,(H,39,42,43)/b18-15+ |
| InChIKey | WVELOPBTTBSYEH-OBGWFSINSA-N |
| XLogP | 5.71 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.88 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|