C27H43ClN6O7 — CID 175814718
3-[3-methyl-2-oxo-5-[2-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethoxy]ethylamino]benzimidazol-1-yl]piperidine-2,6-dione;hydrochloride (PubChem CID 175814718) has the molecular formula C27H43ClN6O7 and a molecular weight of 599.13 g/mol. Its IUPAC name is 3-[3-methyl-2-oxo-5-[2-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethoxy]ethylamino]benzimidazol-1-yl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[3-methyl-2-oxo-5-[2-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethoxy]ethylamino]benzimidazol-1-yl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 175814718 |
| Molecular Formula | C27H43ClN6O7 |
| Molecular Weight | 599.13 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | 3-[3-methyl-2-oxo-5-[2-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethoxy]ethylamino]benzimidazol-1-yl]piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(NCCOCCOCCOCCOCCN3CCNCC3)cc21 |
| InChI | InChI=1S/C27H42N6O7.ClH/c1-31-24-20-21(2-3-22(24)33(27(31)36)23-4-5-25(34)30-26(23)35)29-8-12-37-14-16-39-18-19-40-17-15-38-13-11-32-9-6-28-7-10-32;/h2-3,20,23,28-29H,4-19H2,1H3,(H,30,34,35);1H |
| InChIKey | RJBKHRIVAWNHHD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 137.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.13 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|