C32H34N2O3 — CID 11656181
N,N-dibenzyl-1-[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methanamine (PubChem CID 11656181) has the molecular formula C32H34N2O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is N,N-dibenzyl-1-[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methanamine.
| Compound Name | N,N-dibenzyl-1-[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methanamine |
|---|---|
| PubChem CID | 11656181 |
| Molecular Formula | C32H34N2O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | N,N-dibenzyl-1-[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methanamine |
| SMILES | COc1ccc(O[C@@H]2CN(c3ccc(OC)cc3)[C@@H]2CN(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H34N2O3/c1-35-28-15-13-27(14-16-28)34-24-32(37-30-19-17-29(36-2)18-20-30)31(34)23-33(21-25-9-5-3-6-10-25)22-26-11-7-4-8-12-26/h3-20,31-32H,21-24H2,1-2H3/t31-,32-/m1/s1 |
| InChIKey | CXDRKLBQWKUTRL-ROJLCIKYSA-N |
| XLogP | 6.04 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|