C20H22N2O3S — CID 102101105
[(2S,3S)-3-[(1-methylindol-3-yl)methyl]-1-(4-methylphenyl)sulfonylaziridin-2-yl]methanol (PubChem CID 102101105) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is [(2S,3S)-3-[(1-methylindol-3-yl)methyl]-1-(4-methylphenyl)sulfonylaziridin-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[(1-methylindol-3-yl)methyl]-1-(4-methylphenyl)sulfonylaziridin-2-yl]methanol |
|---|---|
| PubChem CID | 102101105 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [(2S,3S)-3-[(1-methylindol-3-yl)methyl]-1-(4-methylphenyl)sulfonylaziridin-2-yl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](CO)[C@@H]2Cc2cn(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-14-7-9-16(10-8-14)26(24,25)22-19(20(22)13-23)11-15-12-21(2)18-6-4-3-5-17(15)18/h3-10,12,19-20,23H,11,13H2,1-2H3/t19-,20+,22?/m0/s1 |
| InChIKey | PBQODQQQIZDQQX-RJKSWSIASA-N |
| XLogP | 2.46 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|