C27H27IN2O4S — CID 132547171
N-(3,5-dimethoxyphenyl)-N-[(Z)-2-iodo-3-(1-methylindol-3-yl)prop-1-enyl]-4-methylbenzenesulfonamide (PubChem CID 132547171) has the molecular formula C27H27IN2O4S and a molecular weight of 602.49 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-N-[(Z)-2-iodo-3-(1-methylindol-3-yl)prop-1-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-N-[(Z)-2-iodo-3-(1-methylindol-3-yl)prop-1-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 132547171 |
| Molecular Formula | C27H27IN2O4S |
| Molecular Weight | 602.49 g/mol |
| Exact Mass | 602.07 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-N-[(Z)-2-iodo-3-(1-methylindol-3-yl)prop-1-enyl]-4-methylbenzenesulfonamide |
| SMILES | COc1cc(OC)cc(N(/C=C(\I)Cc2cn(C)c3ccccc23)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C27H27IN2O4S/c1-19-9-11-25(12-10-19)35(31,32)30(22-14-23(33-3)16-24(15-22)34-4)18-21(28)13-20-17-29(2)27-8-6-5-7-26(20)27/h5-12,14-18H,13H2,1-4H3/b21-18- |
| InChIKey | KLMXJIPKSPHEMF-UZYVYHOESA-N |
| XLogP | 6.22 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.49 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|