C22H16N2O4S — CID 101443949
13-methyl-11-(4-nitrophenyl)sulfonyl-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaene (PubChem CID 101443949) has the molecular formula C22H16N2O4S and a molecular weight of 404.45 g/mol. Its IUPAC name is 13-methyl-11-(4-nitrophenyl)sulfonyl-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaene.
| Compound Name | 13-methyl-11-(4-nitrophenyl)sulfonyl-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaene |
|---|---|
| PubChem CID | 101443949 |
| Molecular Formula | C22H16N2O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 13-methyl-11-(4-nitrophenyl)sulfonyl-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaene |
| SMILES | Cc1ccc2c3c(cc4ccccc42)CN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)c13 |
| InChI | InChI=1S/C22H16N2O4S/c1-14-6-11-20-19-5-3-2-4-15(19)12-16-13-23(22(14)21(16)20)29(27,28)18-9-7-17(8-10-18)24(25)26/h2-12H,13H2,1H3 |
| InChIKey | CSFTWJRIDGZADB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|