C18H19N3O4S2 — CID 7537371
(1R)-2-(benzenesulfonyl)-4,5-dimethyl-1-(3-nitrophenyl)imino-3,6-dihydrothiazine (PubChem CID 7537371) has the molecular formula C18H19N3O4S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is (1R)-2-(benzenesulfonyl)-4,5-dimethyl-1-(3-nitrophenyl)imino-3,6-dihydrothiazine.
| Compound Name | (1R)-2-(benzenesulfonyl)-4,5-dimethyl-1-(3-nitrophenyl)imino-3,6-dihydrothiazine |
|---|---|
| PubChem CID | 7537371 |
| Molecular Formula | C18H19N3O4S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | (1R)-2-(benzenesulfonyl)-4,5-dimethyl-1-(3-nitrophenyl)imino-3,6-dihydrothiazine |
| SMILES | CC1=C(C)C/[S@](=N\c2cccc([N+](=O)[O-])c2)N(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C18H19N3O4S2/c1-14-12-20(27(24,25)18-9-4-3-5-10-18)26(13-15(14)2)19-16-7-6-8-17(11-16)21(22)23/h3-11H,12-13H2,1-2H3/t26-/m1/s1 |
| InChIKey | AEMBIRNUNWZLNJ-AREMUKBSSA-N |
| XLogP | 3.98 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|