C11H12N3O4S+ — CID 101181308
1,2-dimethyl-3-(3-nitrophenyl)sulfonylimidazol-1-ium (PubChem CID 101181308) has the molecular formula C11H12N3O4S+ and a molecular weight of 282.30 g/mol. Its IUPAC name is 1,2-dimethyl-3-(3-nitrophenyl)sulfonylimidazol-1-ium.
| Compound Name | 1,2-dimethyl-3-(3-nitrophenyl)sulfonylimidazol-1-ium |
|---|---|
| PubChem CID | 101181308 |
| Molecular Formula | C11H12N3O4S+ |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 1,2-dimethyl-3-(3-nitrophenyl)sulfonylimidazol-1-ium |
| SMILES | Cc1n(S(=O)(=O)c2cccc([N+](=O)[O-])c2)cc[n+]1C |
| InChI | InChI=1S/C11H12N3O4S/c1-9-12(2)6-7-13(9)19(17,18)11-5-3-4-10(8-11)14(15)16/h3-8H,1-2H3/q+1 |
| InChIKey | FUAFUHFKCMZQIN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 86.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|