C14H13NO4S — CID 86200243
1,3-dimethyl-2-(4-nitrophenyl)sulfonylbenzene (PubChem CID 86200243) has the molecular formula C14H13NO4S and a molecular weight of 291.33 g/mol. Its IUPAC name is 1,3-dimethyl-2-(4-nitrophenyl)sulfonylbenzene.
| Compound Name | 1,3-dimethyl-2-(4-nitrophenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 86200243 |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 1,3-dimethyl-2-(4-nitrophenyl)sulfonylbenzene |
| SMILES | Cc1cccc(C)c1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H13NO4S/c1-10-4-3-5-11(2)14(10)20(18,19)13-8-6-12(7-9-13)15(16)17/h3-9H,1-2H3 |
| InChIKey | RAMIDZMAKQAELX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|