C10H8N2O5S — CID 67718718
2-methyl-5-(4-nitrophenyl)sulfonyl-1,3-oxazole (PubChem CID 67718718) has the molecular formula C10H8N2O5S and a molecular weight of 268.25 g/mol. Its IUPAC name is 2-methyl-5-(4-nitrophenyl)sulfonyl-1,3-oxazole.
| Compound Name | 2-methyl-5-(4-nitrophenyl)sulfonyl-1,3-oxazole |
|---|---|
| PubChem CID | 67718718 |
| Molecular Formula | C10H8N2O5S |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 2-methyl-5-(4-nitrophenyl)sulfonyl-1,3-oxazole |
| SMILES | Cc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C10H8N2O5S/c1-7-11-6-10(17-7)18(15,16)9-4-2-8(3-5-9)12(13)14/h2-6H,1H3 |
| InChIKey | QXEFZTXUXBFGMT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 103.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|