C30H28N2O3S — CID 177433467
(12Z)-15-methoxy-10-(4-methylphenyl)sulfonyl-2-phenyl-2,10-diazatricyclo[12.4.0.03,8]octadeca-1(14),3,5,7,12,15,17-heptaene (PubChem CID 177433467) has the molecular formula C30H28N2O3S and a molecular weight of 496.63 g/mol. Its IUPAC name is (12Z)-15-methoxy-10-(4-methylphenyl)sulfonyl-2-phenyl-2,10-diazatricyclo[12.4.0.03,8]octadeca-1(14),3,5,7,12,15,17-heptaene.
| Compound Name | (12Z)-15-methoxy-10-(4-methylphenyl)sulfonyl-2-phenyl-2,10-diazatricyclo[12.4.0.03,8]octadeca-1(14),3,5,7,12,15,17-heptaene |
|---|---|
| PubChem CID | 177433467 |
| Molecular Formula | C30H28N2O3S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | (12Z)-15-methoxy-10-(4-methylphenyl)sulfonyl-2-phenyl-2,10-diazatricyclo[12.4.0.03,8]octadeca-1(14),3,5,7,12,15,17-heptaene |
| SMILES | COc1cccc2c1/C=C\CN(S(=O)(=O)c1ccc(C)cc1)Cc1ccccc1N2c1ccccc1 |
| InChI | InChI=1S/C30H28N2O3S/c1-23-17-19-26(20-18-23)36(33,34)31-21-9-13-27-29(15-8-16-30(27)35-2)32(25-11-4-3-5-12-25)28-14-7-6-10-24(28)22-31/h3-20H,21-22H2,1-2H3/b13-9- |
| InChIKey | WUQDYPVZNSFZNM-LCYFTJDESA-N |
| XLogP | 6.69 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |