C14H17NO3S — CID 177402048
5-methyl-1-(4-methylphenyl)sulfonyl-2,7-dihydroazepin-4-ol (PubChem CID 177402048) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is 5-methyl-1-(4-methylphenyl)sulfonyl-2,7-dihydroazepin-4-ol.
| Compound Name | 5-methyl-1-(4-methylphenyl)sulfonyl-2,7-dihydroazepin-4-ol |
|---|---|
| PubChem CID | 177402048 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 5-methyl-1-(4-methylphenyl)sulfonyl-2,7-dihydroazepin-4-ol |
| SMILES | CC1=CCN(S(=O)(=O)c2ccc(C)cc2)CC=C1O |
| InChI | InChI=1S/C14H17NO3S/c1-11-3-5-13(6-4-11)19(17,18)15-9-7-12(2)14(16)8-10-15/h3-8,16H,9-10H2,1-2H3 |
| InChIKey | QOXREMVZGKZKGM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |