C27H31NO3S — CID 85172515
1-[1-(benzenesulfonyl)-3-naphthalen-2-ylaziridin-2-yl]nonan-1-one (PubChem CID 85172515) has the molecular formula C27H31NO3S and a molecular weight of 449.62 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)-3-naphthalen-2-ylaziridin-2-yl]nonan-1-one.
| Compound Name | 1-[1-(benzenesulfonyl)-3-naphthalen-2-ylaziridin-2-yl]nonan-1-one |
|---|---|
| PubChem CID | 85172515 |
| Molecular Formula | C27H31NO3S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 1-[1-(benzenesulfonyl)-3-naphthalen-2-ylaziridin-2-yl]nonan-1-one |
| SMILES | CCCCCCCCC(=O)C1C(c2ccc3ccccc3c2)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H31NO3S/c1-2-3-4-5-6-10-17-25(29)27-26(23-19-18-21-13-11-12-14-22(21)20-23)28(27)32(30,31)24-15-8-7-9-16-24/h7-9,11-16,18-20,26-27H,2-6,10,17H2,1H3 |
| InChIKey | PPDYVHMULBKXCF-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|