C19H22ClNO4S — CID 126652448
[(2S)-5-[(4-chlorophenyl)methyl]-4-(4-methylphenyl)sulfonylmorpholin-2-yl]methanol (PubChem CID 126652448) has the molecular formula C19H22ClNO4S and a molecular weight of 395.91 g/mol. Its IUPAC name is [(2S)-5-[(4-chlorophenyl)methyl]-4-(4-methylphenyl)sulfonylmorpholin-2-yl]methanol.
| Compound Name | [(2S)-5-[(4-chlorophenyl)methyl]-4-(4-methylphenyl)sulfonylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 126652448 |
| Molecular Formula | C19H22ClNO4S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [(2S)-5-[(4-chlorophenyl)methyl]-4-(4-methylphenyl)sulfonylmorpholin-2-yl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](CO)OCC2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H22ClNO4S/c1-14-2-8-19(9-3-14)26(23,24)21-11-18(12-22)25-13-17(21)10-15-4-6-16(20)7-5-15/h2-9,17-18,22H,10-13H2,1H3/t17?,18-/m0/s1 |
| InChIKey | FOIHJCROFZGJIR-ZVAWYAOSSA-N |
| XLogP | 2.64 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |