C19H31ClN2O2 — CID 155576987
[5-[(4-chlorophenyl)methyl]-4-piperidin-4-ylmorpholin-2-yl]methanol;ethane (PubChem CID 155576987) has the molecular formula C19H31ClN2O2 and a molecular weight of 354.92 g/mol. Its IUPAC name is [5-[(4-chlorophenyl)methyl]-4-piperidin-4-ylmorpholin-2-yl]methanol;ethane.
| Compound Name | [5-[(4-chlorophenyl)methyl]-4-piperidin-4-ylmorpholin-2-yl]methanol;ethane |
|---|---|
| PubChem CID | 155576987 |
| Molecular Formula | C19H31ClN2O2 |
| Molecular Weight | 354.92 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | [5-[(4-chlorophenyl)methyl]-4-piperidin-4-ylmorpholin-2-yl]methanol;ethane |
| SMILES | CC.OCC1CN(C2CCNCC2)C(Cc2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C17H25ClN2O2.C2H6/c18-14-3-1-13(2-4-14)9-16-12-22-17(11-21)10-20(16)15-5-7-19-8-6-15;1-2/h1-4,15-17,19,21H,5-12H2;1-2H3 |
| InChIKey | DZFMOESFKOANQO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.92 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |