C20H33ClN2O2S — CID 155577029
5-[(4-chlorophenyl)methyl]-2-(methylsulfinylmethyl)-4-piperidin-4-ylmorpholine;ethane (PubChem CID 155577029) has the molecular formula C20H33ClN2O2S and a molecular weight of 401.02 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methyl]-2-(methylsulfinylmethyl)-4-piperidin-4-ylmorpholine;ethane.
| Compound Name | 5-[(4-chlorophenyl)methyl]-2-(methylsulfinylmethyl)-4-piperidin-4-ylmorpholine;ethane |
|---|---|
| PubChem CID | 155577029 |
| Molecular Formula | C20H33ClN2O2S |
| Molecular Weight | 401.02 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 5-[(4-chlorophenyl)methyl]-2-(methylsulfinylmethyl)-4-piperidin-4-ylmorpholine;ethane |
| SMILES | CC.CS(=O)CC1CN(C2CCNCC2)C(Cc2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C18H27ClN2O2S.C2H6/c1-24(22)13-18-11-21(16-6-8-20-9-7-16)17(12-23-18)10-14-2-4-15(19)5-3-14;1-2/h2-5,16-18,20H,6-13H2,1H3;1-2H3 |
| InChIKey | ITYIZLDGOFSSQI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.02 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |