C19H28ClN3O — CID 155765909
(7S,9aR)-7-[(4-chlorophenyl)methyl]-8-piperidin-4-yl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 155765909) has the molecular formula C19H28ClN3O and a molecular weight of 349.91 g/mol. Its IUPAC name is (7S,9aR)-7-[(4-chlorophenyl)methyl]-8-piperidin-4-yl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (7S,9aR)-7-[(4-chlorophenyl)methyl]-8-piperidin-4-yl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 155765909 |
| Molecular Formula | C19H28ClN3O |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | (7S,9aR)-7-[(4-chlorophenyl)methyl]-8-piperidin-4-yl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | Clc1ccc(C[C@H]2CN3CCOC[C@H]3CN2C2CCNCC2)cc1 |
| InChI | InChI=1S/C19H28ClN3O/c20-16-3-1-15(2-4-16)11-18-12-22-9-10-24-14-19(22)13-23(18)17-5-7-21-8-6-17/h1-4,17-19,21H,5-14H2/t18-,19+/m0/s1 |
| InChIKey | ZSSUPBFNTFOGNA-RBUKOAKNSA-N |
| XLogP | 2.02 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |