C21H30ClN7 — CID 137397470
3-[4-[(8aS)-3-[(4-chlorophenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine (PubChem CID 137397470) has the molecular formula C21H30ClN7 and a molecular weight of 415.97 g/mol. Its IUPAC name is 3-[4-[(8aS)-3-[(4-chlorophenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[4-[(8aS)-3-[(4-chlorophenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 137397470 |
| Molecular Formula | C21H30ClN7 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-[4-[(8aS)-3-[(4-chlorophenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine |
| SMILES | Nc1nc(N2CCC(N3C[C@@H]4CCCN4CC3Cc3ccc(Cl)cc3)CC2)n[nH]1 |
| InChI | InChI=1S/C21H30ClN7/c22-16-5-3-15(4-6-16)12-19-13-28-9-1-2-18(28)14-29(19)17-7-10-27(11-8-17)21-24-20(23)25-26-21/h3-6,17-19H,1-2,7-14H2,(H3,23,24,25,26)/t18-,19?/m0/s1 |
| InChIKey | FMVOJJFOZGTECJ-OYKVQYDMSA-N |
| XLogP | 2.40 |
| TPSA | 77.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |