C21H30ClN7O — CID 155765771
3-[4-[(7S,9aR)-7-[(4-chlorophenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine (PubChem CID 155765771) has the molecular formula C21H30ClN7O and a molecular weight of 431.97 g/mol. Its IUPAC name is 3-[4-[(7S,9aR)-7-[(4-chlorophenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[4-[(7S,9aR)-7-[(4-chlorophenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 155765771 |
| Molecular Formula | C21H30ClN7O |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 3-[4-[(7S,9aR)-7-[(4-chlorophenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine |
| SMILES | Nc1nc(N2CCC(N3C[C@@H]4COCCN4C[C@@H]3Cc3ccc(Cl)cc3)CC2)n[nH]1 |
| InChI | InChI=1S/C21H30ClN7O/c22-16-3-1-15(2-4-16)11-18-12-28-9-10-30-14-19(28)13-29(18)17-5-7-27(8-6-17)21-24-20(23)25-26-21/h1-4,17-19H,5-14H2,(H3,23,24,25,26)/t18-,19+/m0/s1 |
| InChIKey | QZUBYYDZTMVCDQ-RBUKOAKNSA-N |
| XLogP | 1.64 |
| TPSA | 86.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |