C26H42ClN3O3 — CID 155577050
tert-butyl 4-[7-[(4-chlorophenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]piperidine-1-carboxylate;ethane (PubChem CID 155577050) has the molecular formula C26H42ClN3O3 and a molecular weight of 480.09 g/mol. Its IUPAC name is tert-butyl 4-[7-[(4-chlorophenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[7-[(4-chlorophenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 155577050 |
| Molecular Formula | C26H42ClN3O3 |
| Molecular Weight | 480.09 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | tert-butyl 4-[7-[(4-chlorophenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]piperidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCC(N2CC3COCCN3CC2Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H36ClN3O3.C2H6/c1-24(2,3)31-23(29)26-10-8-20(9-11-26)28-16-22-17-30-13-12-27(22)15-21(28)14-18-4-6-19(25)7-5-18;1-2/h4-7,20-22H,8-17H2,1-3H3;1-2H3 |
| InChIKey | LGWYURMLBHAAEU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.09 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |