C23H33ClN2O3 — CID 126642112
tert-butyl 4-[(3S)-3-[(4-chlorophenyl)methyl]-6-methylidene-1,4-oxazepan-4-yl]piperidine-1-carboxylate (PubChem CID 126642112) has the molecular formula C23H33ClN2O3 and a molecular weight of 420.98 g/mol. Its IUPAC name is tert-butyl 4-[(3S)-3-[(4-chlorophenyl)methyl]-6-methylidene-1,4-oxazepan-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3S)-3-[(4-chlorophenyl)methyl]-6-methylidene-1,4-oxazepan-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126642112 |
| Molecular Formula | C23H33ClN2O3 |
| Molecular Weight | 420.98 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | tert-butyl 4-[(3S)-3-[(4-chlorophenyl)methyl]-6-methylidene-1,4-oxazepan-4-yl]piperidine-1-carboxylate |
| SMILES | C=C1COC[C@H](Cc2ccc(Cl)cc2)N(C2CCN(C(=O)OC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C23H33ClN2O3/c1-17-14-26(20-9-11-25(12-10-20)22(27)29-23(2,3)4)21(16-28-15-17)13-18-5-7-19(24)8-6-18/h5-8,20-21H,1,9-16H2,2-4H3/t21-/m0/s1 |
| InChIKey | XLTAHPYZVGWYBF-NRFANRHFSA-N |
| XLogP | 4.54 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.98 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|