C24H31Cl2N3O2S — CID 126670146
(2S)-2,5-bis[(4-chlorophenyl)methyl]-1-methylsulfonyl-4-piperidin-4-ylpiperazine (PubChem CID 126670146) has the molecular formula C24H31Cl2N3O2S and a molecular weight of 496.50 g/mol. Its IUPAC name is (2S)-2,5-bis[(4-chlorophenyl)methyl]-1-methylsulfonyl-4-piperidin-4-ylpiperazine.
| Compound Name | (2S)-2,5-bis[(4-chlorophenyl)methyl]-1-methylsulfonyl-4-piperidin-4-ylpiperazine |
|---|---|
| PubChem CID | 126670146 |
| Molecular Formula | C24H31Cl2N3O2S |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | (2S)-2,5-bis[(4-chlorophenyl)methyl]-1-methylsulfonyl-4-piperidin-4-ylpiperazine |
| SMILES | CS(=O)(=O)N1CC(Cc2ccc(Cl)cc2)N(C2CCNCC2)C[C@@H]1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H31Cl2N3O2S/c1-32(30,31)29-17-23(14-18-2-6-20(25)7-3-18)28(22-10-12-27-13-11-22)16-24(29)15-19-4-8-21(26)9-5-19/h2-9,22-24,27H,10-17H2,1H3/t23?,24-/m0/s1 |
| InChIKey | KRNQXEAZFNJCOD-CGAIIQECSA-N |
| XLogP | 3.85 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |