C18H26ClNO — CID 170197390
(2S,5S)-5-[(4-chlorophenyl)methyl]-4-cyclohexyl-2-methylmorpholine (PubChem CID 170197390) has the molecular formula C18H26ClNO and a molecular weight of 307.86 g/mol. Its IUPAC name is (2S,5S)-5-[(4-chlorophenyl)methyl]-4-cyclohexyl-2-methylmorpholine.
| Compound Name | (2S,5S)-5-[(4-chlorophenyl)methyl]-4-cyclohexyl-2-methylmorpholine |
|---|---|
| PubChem CID | 170197390 |
| Molecular Formula | C18H26ClNO |
| Molecular Weight | 307.86 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (2S,5S)-5-[(4-chlorophenyl)methyl]-4-cyclohexyl-2-methylmorpholine |
| SMILES | C[C@H]1CN(C2CCCCC2)[C@@H](Cc2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C18H26ClNO/c1-14-12-20(17-5-3-2-4-6-17)18(13-21-14)11-15-7-9-16(19)10-8-15/h7-10,14,17-18H,2-6,11-13H2,1H3/t14-,18-/m0/s1 |
| InChIKey | MIKBEFCAYZVMMF-KSSFIOAISA-N |
| XLogP | 4.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.86 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |