C22H27BrClN3O — CID 168679103
(2S,5S)-4-[1-(2-bromo-4-pyridinyl)piperidin-4-yl]-5-[(4-chlorophenyl)methyl]-2-methylmorpholine (PubChem CID 168679103) has the molecular formula C22H27BrClN3O and a molecular weight of 464.84 g/mol. Its IUPAC name is (2S,5S)-4-[1-(2-bromo-4-pyridinyl)piperidin-4-yl]-5-[(4-chlorophenyl)methyl]-2-methylmorpholine.
| Compound Name | (2S,5S)-4-[1-(2-bromo-4-pyridinyl)piperidin-4-yl]-5-[(4-chlorophenyl)methyl]-2-methylmorpholine |
|---|---|
| PubChem CID | 168679103 |
| Molecular Formula | C22H27BrClN3O |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | (2S,5S)-4-[1-(2-bromo-4-pyridinyl)piperidin-4-yl]-5-[(4-chlorophenyl)methyl]-2-methylmorpholine |
| SMILES | C[C@H]1CN(C2CCN(c3ccnc(Br)c3)CC2)[C@@H](Cc2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C22H27BrClN3O/c1-16-14-27(21(15-28-16)12-17-2-4-18(24)5-3-17)19-7-10-26(11-8-19)20-6-9-25-22(23)13-20/h2-6,9,13,16,19,21H,7-8,10-12,14-15H2,1H3/t16-,21-/m0/s1 |
| InChIKey | XKOHFKDLEGRIDZ-KKSFZXQISA-N |
| XLogP | 4.80 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|